Systematic / IUPAC Name: N-[[(2R,4S,5R)-5-[6-(Furan-2-yl)-2-methylpyrimidin-4-yl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-2-thiophen-2-ylacetamide
ID: Reference9941
Other Names:
2-Thiopheneacetamide, N-[[(2R,4S,5R)-5-[6-(2-furanyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-342931
Formula: C23H26N4O2S
N-({(2R,4S,5R)-5-[6-(2-Furyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl}methyl)-2-(2-thienyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2119 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/17/2020 10:16:20 AM |
| InChI | InChI=1S/C23H26N4O2S/c1-15-25-20(12-21(26-15)22-5-2-8-29-22)19-14-27-7-6-16(19)10-17(27)13-24-23(28)11-18-4-3-9-30-18/h2-5,8-9,12,16-17,19H,6-7,10-11,13-14H2,1H3,(H,24,28)/t16-,17+,19-/m0/s1 |
| InChI Key | GOBCDBQOTPKVIT-SCTDSRPQSA-N |
| Canonical SMILES | CC1=NC(=CC(=N1)C2CN3CCC2CC3CNC(=O)CC4=CC=CS4)C5=CC=CO5 |
| CAS | |
| Splash | |
| Other Names |
2-Thiopheneacetamide, N-[[(2R,4S,5R)-5-[6-(2-furanyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-342931 |