Systematic / IUPAC Name: 1-(4-Acetylphenyl)-3-[[(2R,4S,5R)-5-[6-(furan-2-yl)-2-methylpyrimidin-4-yl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]urea
ID: Reference9943
Other Names:
Urea, N-(4-acetylphenyl)-N'-[[(2R,4S,5R)-5-[6-(2-furanyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-342983
Formula: C26H29N5O3
1-(4-Acetylphenyl)-3-({(2R,4S,5R)-5-[6-(2-furyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl}methyl)urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3721 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/17/2020 10:18:07 AM |
| InChI | InChI=1S/C26H29N5O3/c1-16(32)18-5-7-20(8-6-18)30-26(33)27-14-21-12-19-9-10-31(21)15-22(19)23-13-24(29-17(2)28-23)25-4-3-11-34-25/h3-8,11,13,19,21-22H,9-10,12,14-15H2,1-2H3,(H2,27,30,33)/t19-,21+,22-/m0/s1 |
| InChI Key | VEOVDGSQVHSJMK-NNWRFLSQSA-N |
| Canonical SMILES | CC1=NC(=CC(=N1)C2CN3CCC2CC3CNC(=O)NC4=CC=C(C=C4)C(=O)C)C5=CC=CO5 |
| CAS | |
| Splash | |
| Other Names |
Urea, N-(4-acetylphenyl)-N'-[[(2R,4S,5R)-5-[6-(2-furanyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-342983 |