Systematic / IUPAC Name: 2-[(3S)-1-(1,3-Benzodioxol-5-ylmethyl)pyrrolidin-3-yl]-5-(1H-indol-3-ylmethyl)-1,3,4-oxadiazole
ID: Reference9979
Other Names:
1H-Indole, 3-[[5-[(3S)-1-(1,3-benzodioxol-5-ylmethyl)-3-pyrrolidinyl]-1,3,4-oxadiazol-2-yl]methyl]-;
NAT31-459359
Formula: C23H22N4O3
3-({5-[(3S)-1-(1,3-Benzodioxol-5-ylmethyl)-3-pyrrolidinyl]-1,3,4-oxadiazol-2-yl}methyl)-1H-indole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 829 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/8/2020 9:43:42 AM |
| InChI | InChI=1S/C23H22N4O3/c1-2-4-19-18(3-1)17(11-24-19)10-22-25-26-23(30-22)16-7-8-27(13-16)12-15-5-6-20-21(9-15)29-14-28-20/h1-6,9,11,16,24H,7-8,10,12-14H2/t16-/m0/s1 |
| InChI Key | VTXNROARQHTBTM-INIZCTEOSA-N |
| Canonical SMILES | C1CN(CC1C2=NN=C(O2)CC3=CNC4=CC=CC=C43)CC5=CC6=C(C=C5)OCO6 |
| CAS | |
| Splash | |
| Other Names |
1H-Indole, 3-[[5-[(3S)-1-(1,3-benzodioxol-5-ylmethyl)-3-pyrrolidinyl]-1,3,4-oxadiazol-2-yl]methyl]-; NAT31-459359 |